Physics, 12.12.2019 21:31, kps26pd2mea

A5.0-kg object is lifted to a height of 3.2 m. by how much does its gravitational energy increase?

180 j

16 j

160 j

47 j

Answers: 2

Show answers

Answers

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

Ithink they do have the same properties just in less quantities i think

answered: Guest

note: the given question is incomplete.

complete question is given below.

which is an example of kinetic energy?

a. the energy stored in ethanol

b. a hockey puck sliding across the ice

c. a compressed spring

d. a ball sitting at the top of a ramp

solution: the kinetic energy is the energy posses by the virtue of the motion of the object.

in the given options, a, c and d are the example of potential energy because it is the energy posses by the virtue of the rest of the object. but option b has the kinetic energy as the object is in motion.

hence, a hockey puck sliding across the ice is the apex example of kinetic energy.

so, the option (b) a hockey puck sliding across the ice is the correct option.

answered: Guest

When you go to ask a qustion there will be a picture of a paper clip looking thing and then it will pop up your files and you click on the imajes and then you up load it

Other questions on the subject: Physics

Physics, 21.06.2019 19:40, 20170020

Apackage of supplies is dropped from a plane, and one second later a second package is dropped. neglecting air resistance, the relative velocity of the 1st package viewed from the second will 56) a) increase. b) be constant. c) be zero. d) depend upon their weight. e) decrease

Answers: 1

continue

Physics, 22.06.2019 02:40, esheagustafson

What happens when chlorine reacts with bromine? a. electrons move from the chlorine atoms to the bromine atoms. b. electrons move from the bromine atoms to the chlorine atoms. c. electrons are shared between the chlorine atoms and the bromine atoms. d. electrons become delocalized among the atoms.

Answers: 2

continue

Physics, 22.06.2019 13:30, Travisbennington

Which is not an example of how an object gains elastic potential energy by stretching? a. jumping on a pogo stick b. pulling on a rubber band c. jumping on a trampoline

Answers: 1

continue

Physics, 22.06.2019 15:30, pandapractice6834

Aforce of 100 newtons is used to move an object a distance of 15 meters with a power of 50 watts. find the work dine and the time it takes to do the work

Answers: 1

continue

Do you know the correct answer?

A5.0-kg object is lifted to a height of 3.2 m. by how much does its gravitational energy increase? <...