Physics, 01.10.2019 16:30, stephanieanaya7

Aparticle of mass m moves under a conservative force with potential energy v ( x )= cx/(x2+a2),where c and a are positive constants. find the position of stable equilibrium and the period of small oscillations about it. (b) if the particle starts from this point with velocity v, find the r

Answers: 3

Show answers

Answers

answered: lashondrascott

The position of stable equilibrium is -a

And the period of small oscillations must be: c/(ma^3)

Explanation:

Since the potential is:

$V(x) = \frac{c x}{a^2+x^2}$

We first look for a position of stable equilibrium. This posiiton must satisfy two considtions, that the first derivative of the potential must vanish at this point and the second derivative must be positive.

$V'(x) = \frac{c}{a^2+x^2}-\frac{2 c x^2}{\left(a^2+x^2\right)^2}$

Which vanish for

x = a ; x =-a

The second derivative of V(x) is:

$V''(x) = \frac{8 c x^3}{\left(a^2+x^2\right)^3}-\frac{6 c x}{\left(a^2+x^2\right)^2}$

And:

$V''(a) = -\frac{c}{2 a^3}\\V''(-a) = \frac{c}{2 a^3}\\$

Therefore:

The position of stable equilibrium is -a

And the period of small oscillations must be:

$\omega = \sqrt{2 V''(-a)/m} = \sqrt{\frac{c}{a^3 m}}$

(c/(ma^3))^1/2

Let's find the maximum amplitude if the particle starts at this point with velocity v

If this is the case, the total energy will be:

(mv^2)/2

And the maximum amplitude will be

x = a^3/c mv^2 = (m v^2 a^3)/ c

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

pecialized keyboards