This diagram represents the synthesis of nitrogen monoxide. write a balanced equation of this chemical reaction. a) n2(g) + o2(g) → no(g) b) n2(g) + o2(g) → 2no(g) c) n2(g) + 2o2(g) → no2(g) d) 2n2(g) + 2o2(g) → 2no(g)

The only balanced equation is B. 

If you look at the equation and break it down you can see that in:

→ 

Starting from the left side of the equation there are 2 Nitrogen atoms, and 2 oxygen atoms as indicated by the subscript. 

To balance the equation, the number of atoms of each element in the right side equation should be equal to left. By putting the numerical coefficient of 2, you will distribute that to each element. So you will end up with 2 nitrogen atoms and 2 oxygen atoms on the left side of the equation. Thus, the equation is balanced. 

The answer again, is B. 

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o