Physics, 07.07.2019 09:20, ainhoagmz903

Describe how mass and distance affect gravitational force?

Answers: 1

Show answers

Answers

answered: Jadalamanna

Explanation:

The Newton's law of gravitation gives the force acting between two bodies when they are separated by some distance. Mathematically, it is given by :

$F=G\dfrac{m_1m_2}{d^2}$

It shows that the gravitational force is directly proportional to the product of masses of two bodies and inversely proportional to the square of distance between them.

So, as the mass of bodies increases, the gravitational force increases and with the increase of distance between them, the gravitational force decreases.

answered: Guest

answer

c, on a nylon carpet in a dry area. give me brainliest

explanation:

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 23:00, 21hendlill

How are calculation for velocity and speed different

Answers: 1

continue

Physics, 22.06.2019 00:00, cookies1164

Describe different biomes. what are some adaptations that organisms (plants or animals) must have to live in each biome?

Answers: 1

continue

Physics, 22.06.2019 07:00, math1325

How do you tell if someone actually cares about you? and just say they do?

Answers: 2

continue

Physics, 22.06.2019 15:30, haha81

Identify the correct relation showing that the radius r of the orbit of a moon of a given planet can be determined from the radius r of the planet, the acceleration of gravity at the surface of the planet, and the time τ required by the moon to complete one full revolution about the planet. determine the acceleration of gravity at the surface of the planet jupiter knowing that r = 71 492 km and that t= 3.551 days and r= 670.9 × 10^3 km for its moon europa.