Physics, 20.08.2019 00:30, longboard5967

Amicrowave oven emits a microwave with a wavelength of 2.00 × 10^−2 meter in air. calculate the
frequency of the microwave. [show all work, including the equation and substitution with units.]

Answers: 1

Show answers

Answers

Frequency = (speed) / (wavelength)

The speed of microwave is the same as the speed of TV signals,
X-rays, and heat radiation. We call it the "speed of light".

It's not exactly, but very close to, 3 x 10⁸ m/s, in vacuum or air.

Frequency =

(3 x 10⁸ meter per sec) / (2.0 x 10⁻² meter) =

1.5 x 10¹⁰ per sec = 15 GHz .

Using the information given in the question, this is the answer.
But in the real world, its very inaccurate.

The real wavelength of the radio waves inside the microwave oven is
more like 12 cm, not 2.0 cm. The ovens operate at 2.56 GHz in the US.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

Sorry my friend i don't know the answer. i am just in 6th
Me : ) it doesn't need to be a paragraph just a list

Other questions on the subject: Physics

Physics, 22.06.2019 01:00, tulensru02

Velocity is a description of both speed and direction, therefore it - a vector - a force arrow - the same as acceleration - a magnitude

Answers: 1

continue

Physics, 22.06.2019 04:00, tamyahamlin02p6b7yt

Determine the maximum r-value of the polar equation r =3+3 cos 0

Answers: 3

continue

Physics, 22.06.2019 05:30, jalexus

Thomas his older brothers, who own a junk yard, on the weekends to earn extra money. he likes to them push broken-down cars to the back of the junk yard because it makes him feel strong. last saturday, they pushed three cars with different weights, and he noticed he used different amounts of force for each one. the cars were the following weights: white car: 2,700 kg red car: 1,500 kg blue car: 2,100 kg think about how much force is needed to move each car. which correctly lists the cars in order from the most to least amount of force needed to move them? a) white, blue, red b) blue, red, white c) red, white, blue d) white, red, blue

Answers: 2

continue

Physics, 22.06.2019 14:00, tonytashaqua

Me pl give an example of a collision in real life. use the law of conservation of energy to describe the transfer of momentum. be sure and discuss the momentum before and after the collision occurs. you will need at least 3 sentences to thoroughly answer this question.

Answers: 3

continue

Do you know the correct answer?

Amicrowave oven emits a microwave with a wavelength of 2.00 × 10^−2 meter in air. calculate the