Physics, 10.12.2021 08:50, jak000067oyyfia

What is the capaceter

Answers: 1

Show answers

Answers

capacitor, device for storing electrical energy, consisting of two conductors in close proximity and insulated from each other. A simple example of such a storage device is the parallel-plate capacitor.

Explanation:

Hope it's help

please brainless me :)

answered: foodisbae45678

Firstly, it is capacitor not capaceter.Capacitor is an electrical instrument which is used to store electrical charge and it may also releases the charge into a circuit.

Hope you could get an idea from here.

Doubt clarification - use comment section.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

the bal will not change its velocity.

Other questions on the subject: Physics

Physics, 21.06.2019 22:50, periwinkleaqua72

An electron and a proton have the same kinetic energy upon entering a region of constant magnetic field and their velocity vectors are perpendicular to the magnetic field. suppose the magnetic field is strong enough to allow the particles to circle in the field. note: you'll need to look up the masses for an electron and proton. 1) what is the ratio of the radii of their circular paths rp/re?

Answers: 3

continue

Physics, 22.06.2019 04:30, leilaford2003

Afeather of mass 0.001 kg falls from a height of 2 m. under realistic conditions, it experiences air resistance. based on what you know about friction, what can you say about the kinetic energy of the feather as it reaches the ground? acceleration due to gravity is g = 9.8 m/s2. a. ke < 0.0196 j b. ke = 00196 j c. je = 0 j d. ke > 0.0196 j

Answers: 1

continue

Physics, 22.06.2019 05:00, caguil00

Does work output exceed work input when a machine is used? a) yes, it does, as machines create energy. b) it depends on the type of machine used. c) no, it doesn’t, as machines are inefficient. d) no, it doesn’t, as machines cannot create energy.

Answers: 1

continue

Physics, 22.06.2019 10:30, gyexisromero10

Air is to be preheated by hot exhaust gases in a cross-flow heat exchanger before it enters the furnace. air enters the heat exchanger at 95 kpa and 20°c at a rate of 0.6 m^3/s. the combustion gases (cp = 1.10 kj/kg°c) enter at 160°c at a rate of 0.95 kg/s and leave at 95°c. determine the rate of heat transfer to the air and its outlet temperature.

Answers: 2

continue

Do you know the correct answer?

What is the capaceter...