Physics, 23.11.2021 18:30, depaze8400

I want explanation with the correct answer as to why the answer is 0 degree despite refraction of light .

$I want explanation with the correct answer as to why the answer is 0 degree despite refraction of l$

Answers: 3

Show answers

Answers

answered: rue61

Refraction only occurs when the light is incident to the surface at some positive angle. When light is perpendicular to a surface there is no bend to the ray.

Using Snell's law, the math looks like this

n₁sinθ₁ = n₂sinθ₂

at an incidence of 0°

n₁sin(0) = n₂sinθ₂

0 = n₂sinθ₂

as n₂ is always a positive number, sinθ₂ must equal 0 meaning θ₂ = 0

So while there will be refraction of light a position O, which is the exact center of the semicircular prism and the refracted ray will follow a radial line, there will be no refraction of light at P because the light is traveling perpendicular to the surface there. There will be a change in light velocity because of the change in the medium, but no refraction.

Explanation:

answered: Guest

i guess it’s a and b

For which optical devices does d sometimes have a positive value

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 17:00, tiffanibell71

What would the difference of spectral lines emitted by hydrogen gas in distant galaxies which is normally found at a wavelength of 21 cm on earth, be observed at 21.1 centimeters?

Answers: 2

continue

Physics, 22.06.2019 00:30, Waakkaa

Glass is transparent to visibile light under normal conditions; however, at extremely high intensities, glass will absorb most of the light incident upon it. this works through a process known as multiphoton absorption. in this process, several photons are absorbed at the same time. if very intense light whose photons carry 2ev of energy is shined onto a material with a band gap of 4ev, that light can be absorbed through two-photon absorption, because two photons have the right amount of energy to bridge the band gap. what is the minimum number of photons of 800-nm light that are needed to equal or exceed the band gap of fused silica glass

Answers: 1

continue

Physics, 22.06.2019 07:00, bri2728

Disney, viacom and aol time warner are examples of

Answers: 2

continue

Physics, 22.06.2019 13:50, demitae8839

9.98 kg of r-134a at 300 kpa fills a rigid container whose volume is 14 l. determine the temperature and total enthalpy in the container. the container is now heated until the pressure is 600 kpa. determine the temperature and total enthalpy when the heating is completed. use data from the steam tables.

Answers: 1

continue

Do you know the correct answer?

I want explanation with the correct answer as to why the answer is 0 degree despite refraction of li...