Physics, 27.10.2021 14:00, TaraC

Một ôtô đang chạy với tốc độ 12 m/s trên một đoạn đường thẳng thì người lái xe tăng ga cho ôtô chạy nhanh dần đều. Sau 15s ôtô đạt vận tốc 15 m/s. Quãng đường ôtô đi được sau 5s kể từ khi tăng ga là

Answers: 1

Show answers

Answers

answered: Guest

nah. i'm just sleepy.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

1. may 2. september 3. february, and december4. 70°f

answered: Guest

the design of a ski jumping suit involves a trade-off between giving the skiers lift to get higher jumps and ensuring the skier does not face a lot of drag before the jump itself. an expansive suit may to lift the skier higher, but at the same time, it will also increase the air resistance. higher air resistance as the skier goes down the slope limits the speed of the jump. a big suit also increases the risk of losing balance or control, especially if there's a strong gust of wind. while technologically enhanced suits a lot, clothing is not the only factor in a ski jumper’s success. gathering speed while skiing down the slope, ensuring good speed on the ramp, and maintaining good body posture and form in the air all contribute to a ski jumper's success.

Other questions on the subject: Physics

Physics, 22.06.2019 01:10, Katyazamo

The 10-kg double wheel with radius of gyration of 125mm about o is connected to the spring of stiffness k = 600 n/m by a cord which is wrapped securely around the inner hub. if the wheel is released from rest on the incline with the spring stretched 225 mm, calculate the maximum velocity v of its center o during the ensuing motion. the wheel rolls without slipping

Answers: 1

continue

Physics, 22.06.2019 15:30, bloodry

Two point charges are separated by a certain distance. how does the strength of the electric field produced by the first charge, at the position of the second charge, change if the second charge is doubled? a. the field does not change b. the field strength decreases by half. c. the field strength doubles d. the field strength quadruples

Answers: 1

continue

Physics, 22.06.2019 15:30, 573589

The radius of a sphere is increasing at a rate of 9 cm/ sec. find the radius of the sphere when the volume and the radius of the sphere are increasing at the same numerical rate.

Answers: 1

continue

Physics, 22.06.2019 20:00, luceridiaaz

What is the name of the perceived change in a sound wave’s frequency due to motion between the observer and the sound source?

Answers: 1

continue

Do you know the correct answer?

Một ôtô đang chạy với tốc độ 12 m/s trên một đoạn đường thẳng thì người lái xe tăng ga cho ôtô chạy...