Physics, 24.10.2021 18:40, ingridx0

What does Newton's law all about?

Answers: 1

Show answers

Answers

answered: DragonLovely

Newton's law is all about motion

answered: catchonyet

In classical mechanics, Newton's laws of motion are three laws that describe the relationship between the motion of an object and the forces acting on it.

Explanation:

answered: Guest

with the invention of the automobile, the woman of the house could drive to the store and get groceries. women were also free to socialize more. during world war ii women were allowed to work in factories to the war effort and could drive to work or ride mass transit buses to their jobs.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 22:30, celibe9391

What is the earliest point in the universe that we can observe? why can’t we see back further than this?

Answers: 2

continue

Physics, 22.06.2019 19:10, summer132

Global warming will produce rising sea levels partly due to melting ice caps but also due to the expansion of water as average ocean temperatures rise. to get some idea of the size of this effect, calculate the change in length (in m) of a column of water 1.45 km high for a temperature increase of 1.12°c. assume the column is not free to expand sideways. as a model of the ocean, that is a reasonable approximation, as only parts of the ocean very close to

Answers: 3

continue

Physics, 23.06.2019 01:00, pulliamdylan

What electron configurations do atoms usually achieve by sharing electrons to form covalent bonds?

Answers: 3

continue

Physics, 23.06.2019 03:30, ijohnh14

An object is kept at 45 m high and how much time will it take to reach the ground