Physics, 30.08.2021 04:40, dee3874

An ant crawls 50 cm to the right, stops, and then crawls 30 cm to the left. Calculate the distance that the ant travels, and calculate the displacement of the ant.

Answers: 3

Show answers

Answers

answered: doll1234

Answer and Explanation:

If the ant was to crawl 50cm to the right, then come back 30 cm, then the total distance walked would be 80cm.

- Combine 50cm and 30cm to get 80 cm.

For displacement, the answer is 20 cm.

- When calculating displacement, you use the initial (starting) distance. and subtract that from the final distance, giving you the displacement, or the amount traveled from the starting point to the final point if you were to make a straight line from the starting point to end point. (0 to 50, then back 30 the same direction, so subtract 30 from 50 to get 20)

#teamtrees #PAW (Plant And Water)

I hope this helps!

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

For me a person with a phd and who knows what there talking about.i know the chances of a radiation leak is low but if it does the area within a 96.3 mile radius would be unusable because of contamination

Other questions on the subject: Physics

Physics, 21.06.2019 16:30, fatback7063

In which scenario is the least amount of work done on a crate? a force of 120 n moves it 25 m. a force of 115 n moves it 26 m. a force of 130 n moves it 22 m. a force of 125 n moves it 27 m.

Answers: 1

continue

Physics, 21.06.2019 20:10, FinnaCryDotJpeg

Which force is most responsible for binding together an atom's protons and neutrons? electrostatic gravitational nuclear magnetic

Answers: 1

continue

Physics, 22.06.2019 06:10, crystalryan3797

Africtionless piston-cylinder contains 50 l of saturated liquid r-134a. the piston has a mass and an area resulting in an applied pressure of 500 kpa on the refrigerant. the refrigerant is now heated until its temperature rises to 70∘c. calculate the work (in kj) done during this process.

Answers: 3

continue

Physics, 22.06.2019 21:00, tobyfoerst

If the specific heat of a metal is 0.850 j/g °c, what is its atomic weight?

Answers: 2

continue

Do you know the correct answer?

An ant crawls 50 cm to the right, stops, and then crawls 30 cm to the left. Calculate the distance t...