Physics, 21.06.2021 16:00, Poppie9332

Determine the values of m and n when the following average magnetic field strength of the Earth is written in scientific notation: 0.0000451 T. Enter m and n, separated by commas.

Answers: 3

Show answers

Answers

answered: jude3412

B = 4.51×10⁻⁵ T

Explanation:

Given that,

The average magnetic field strength of the Earth is 0.0000451 T.

We need to write the value in the form of scientific notation. Any number in scientific notation is written as follows :

N=a×bⁿ

Where

n is any integer and a is a real no

So,

0.0000451 = 4.51×10⁻⁵ T

So, the required answer is equal to 4.51×10⁻⁵ T.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

as we probably am aware that our atmosphere or air have various levels, each level has different gasses, and each gas has another porousness. at the point when the light originates from lower porousness to higher penetrability, it alters its course. with the goal that implies that when the light originates from the moon to the earth, it alters it's course a lot more occasions. it essentially implies that the state of the light piece of the moon is changed on the earth.

not copied too! hope this !

joke:

h o h o hope you have a merry christmas!

Other questions on the subject: Physics

Physics, 22.06.2019 03:50, Jasten

The intensity of a polarized electromagnetic wave is 12 w/m^2. part a) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=0∘ with the plane of polarization? part b) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=30∘ with the plane of polarization? part c) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=45∘ with the plane of polarization? part d) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=60∘ with the plane of polarization? part e) what will be the intensity after passing through a polarizing filter whose axis makes the angle θ=90∘ with the plane of polarization?

Answers: 1

continue

Physics, 22.06.2019 10:00, xojade

How many times did thomas edison mess up the light bulb

Answers: 1

continue

Physics, 22.06.2019 13:00, Ryleetarver

Discuss how the hardness or softness of the landing surface is related to the time required to stop the egg

Answers: 1

continue

Physics, 22.06.2019 22:00, frisha

If a hiker that weighs 600 newtons climbs a 50 meter hill, how much gravitational potential energy has the hiker gained?