Physics, 11.01.2020 02:31, Isactuallycarter99

If a solid piece of naphthalene is heated and remains at 80c until it is completely melted , you know that 80c is the .?

Answers: 3

Show answers

Answers

answered: Guest

the grams of oxygen gas that can be produced is 20.6 grams of o₂

calculation

2liclo₃ → 2 licl + 3 o₂

step 1: find the moles of liclo₃

moles = mass÷ molar mass

from periodic table the molar mass of liclo₃ =6.9 +35.5 +(16 x3) =90.4 g/mol

moles=38.7 g÷90.4 g/mol=0.4281 moles

step 2: use the mole ratio to calculate the moles of o2

from equation above, liclo₃: o₂ is 2: 3

therefore the moles of o₂=0.4281 moles x3/2 =0.6422 moles

step 3: find mass of o₂

mass= moles x molar mass

from periodic table the molar mass of o₂ = 16 x2= 32 g/mol

mass=0.6422 moles x 32 g/mol = 20.6 grams of o₂

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

reserve is the answer

answered: Guest

The answer is water molecules are split.cellular respiration and photosynthesis are complement reactions to each other. these are reverse reactions. in cellular respiration glucose and oxygen yield water and carbon dioxide. so, when respiration begins, glucose molecules are split. in the opposite reaction - in photosynthesis, carbon dioxide and water yield glucose and oxygen. thus, when respiration begins, water molecules are split.