Physics, 25.09.2019 12:00, kvngsavage156

Which statement is true for electric field lines?
field lines should always be parallel to the equipotential lines.
field lines should always be perpendicular to the equipotential lines.
field lines should always be parallel to each other.
field lines should always be crossing each other.
field lines should always be perpendicular to each other.

Answers: 2

Show answers

Answers

answered: IkweWolf4431

The best answer is D. field lines should always be crossing each other.

answered: sallybob0

The correct statement is

Field lines should always be perpendicular to the equipotential lines.

we know that, along equipotential lines, work done in moving a charge is zero. Since work done is zero, the force on the charge must be perpendicular to the displacement. the electric force on a charge is parallel to the direction of electric field. hence the electric field must be perpendicular to the displacement or equipotential lines.

answered: Guest

4. 50x10= 500m/s 5. 52m/s
First to answer will be the brainliest answer both questions 4 and 5 and don't answer if you don't k

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 00:00, vkyles84

True or false: the revolution of the earth creates day and night as it rotates around the sun

Answers: 2

continue

Physics, 22.06.2019 04:30, leilaford2003

Afeather of mass 0.001 kg falls from a height of 2 m. under realistic conditions, it experiences air resistance. based on what you know about friction, what can you say about the kinetic energy of the feather as it reaches the ground? acceleration due to gravity is g = 9.8 m/s2. a. ke < 0.0196 j b. ke = 00196 j c. je = 0 j d. ke > 0.0196 j

Answers: 1

continue

Physics, 22.06.2019 10:10, princeofpowerjr

Which branches of natural science include the study of an organism that lived 10 million years ago

Answers: 1

continue

Physics, 22.06.2019 11:30, ccamiloggonzales1234

Balloon a has charge q, and identical mass balloon b has charge 10q. you hang them from threads near each other. choose all of the statements with which you agree. check all that apply. a. a and b exert the same magnitude forces on each other. b. the force that a exerts on b is 10 times the force that b exerts on a. c. the angle between the thread supporting a and the vertical is < the angle between the thread supporting b and the vertical. d. the force that a exerts on b is 1/10 the force that b exerts on a.

Answers: 2

continue

Do you know the correct answer?

Which statement is true for electric field lines?
field lines should always be parallel to th...