Consider a system consisting of three particles: m1 = 4 kg, vector v1 = < 10, -5, 15 > m/s, m2 = 9 kg, vector v2 = < -15, 5, -3 > m/s, m3 = 3 kg, vector v3 = < -24, 36, 18 > m/s. A) What is the total momentum of this system?
B) What is the velocity of the center of mass of this system?
C) What is the total kinetic energy of this system?
D) What is the translational kinetic energy of this system?
E) What is the kinetic energy of this system relative to the center of mass?
One way to calculate Krel is to calculate the velocity of each particle relative to the center of mass, by subtracting the center-of-mass velocity from the particle's actual velocity to get the particle's velocity relative to the center of mass, then calculating the corresponding kinetic energy, then adding up the three relative kinetic energies. However, there is a much simpler way to determine the specified quantity, without having to do all those calculations; think about what you know about the relationships among the various kinds of kinetic energy in a multiparticle system.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

No because scientist are still changing there mines today so they are not correct to this day