Consider the following three vectors: A⃗ =(2,−1,1),
B⃗ =(3,0,5),
and
C⃗ =(1,4,−2).
Calculate the following combinations. Express your answers as ordered triplets [e. g., (9,4,−2)].

Part C

A⃗ +B⃗ +C⃗ =

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

If the heat engine is a perfect carnot cycle engine, thenefficiency = (t2-t1)/t2   where t1=temperature of cold reservoir ( ° k) = 135            t2=temperature of hot reservoir ( ° k)   = 325thereforeefficiency = (t2-t1)/t2 = (325-135)/325 = 0.5846 = 58%  note: this is the theoretical maximum efficiency of a perfect heat engine.   real-life engines do not achieve this value.