Physics, 18.02.2021 23:30, ajbrock1004

A cannonball is launched from ground level. The launch angle is 60∘, with an initial speed of vi = 88 m/s. How far away does the cannonball land? Express your answer with the appropriate units.

d =

Answers: 3

Show answers

Answers

answered: Guest

(75°f − 32) × 5/9 = 23.889°c

answered: Guest

i dont think you are wrong for wanting to get even with someone who did you wrong.

(i'm an eye for an eye kind of person) but if this person hurt you in a sexual way, i dont suggest doing anything to him. he should be taken to the proper authorities, you could go to jail depending on what you do. if it was something small like your sibling took your spot on the couch, than yea, i would get even with him by taking one of his favorite snacks lol. but i dont suggest you doing anything illegal.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

iron would move it is magnetic there is a mag field around the current in the wire

Other questions on the subject: Physics

Physics, 21.06.2019 22:00, datgamer13

Bernie drove home from a vacation in 1.5 hours. he traveled a total distance of 60 miles. what was his average speed in miles per hour? a. 60 mph b. 90 mph c. 40 mph d. 55mph

Answers: 1

continue

Physics, 22.06.2019 04:00, ashiteru123

What are the three ways that an object can accelerate

Answers: 2

continue

Physics, 22.06.2019 06:30, robertrkumar1

At very high pressures, gases become and will eventually a) more dense; become hotter b) more dense; change to a liquid or solid c) less dense; combust d) less dense; turn into a liquid

Answers: 2

continue

Physics, 22.06.2019 08:30, ljwatts25

Pl asaaap ! match the term to the correct description. a type of wave that transfers energy where the particles in the medium move perpendicular to the direction in which the energy is traveling. a type of wave that transfers energy where the particles in the medium move parallel to the direction in which the energy is traveling. movement that is back and forth, like an equal sign = a type of wave that transfers energy where the particles in the medium move in a circle motion while the energy travels left or right. movement that is like a t transfers energy from one location to another 1. wave 2. parallel movement 3. perpendicular movement 4. transverse wave 5. longitudinal wave 6. surface wave

Answers: 1

continue

Do you know the correct answer?

A cannonball is launched from ground level. The launch angle is 60∘, with an initial speed of vi = 8...