Physics, 07.02.2021 07:40, janeou17xn

A mass of 10. kg is placed on the end of a 0.50-meter pendulum. What is the period of the pendulum?

Answers: 3

Show answers

Answers

answered: tuetheturtle

T = 1.41 seconds

Explanation:

Given that,

The mass placed in the pendulum, m = 10 kg

The length of the pendulum, l = 0.5 m

We need to find the period of the pendulum. The relation for the period of the pendulum is given by :

$T=2\pi \sqrt{\dfrac{l}{g}} \\\\T=2\pi \sqrt{\dfrac{0.5}{9.8}} \\\\T=1.41\ s$

So, the time period of the pendulum is 1.41 seconds.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

the minimum constant speed at which she can catch the train is 2.7 m/s

given:

acceleration = 0.6 $\frac{m}{s^{2} }$

time = 4.5 s

to find:

velocity = ?

formula used:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

solution:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

v = 0 + (0.6 × 4.5)

v = 2.7 m/s

the minimum constant speed at which she can catch the train is 2.7 m/s

Other questions on the subject: Physics

Physics, 21.06.2019 21:00, Dinojacob

What can be found in every skeletal muscle? a. nerves, bones, cartilage, and connective tissue b. tendons, cartilage, nerves, and blood vessels c. muscle fibers, nerves, connective tissue, and blood vessels d. tendons, nerves, blood vessels, and bones

Answers: 1

continue

Physics, 22.06.2019 03:30, itsRyanPlayzMC9660

Scout feels ill one day before school. her mother puts a thermometer in her mouth and the temperature begins to climb to 100°f. what is happening between the cooler thermometer and scout's body? a) scout's body is applying a force to the particles in the thermometer. b) kinetic energy is being transferred from her mouth to the thermometer. c) potential energy is being lost by the thermometer and gained by scout's body. d) the potential energy stored in foods is converted to mechanical energy to raise the mercury in the thermometer.

Answers: 1

continue

Physics, 22.06.2019 03:50, ash011519

The force acting on a beam was measured under the same operating conditions and a sample of 5 data points was collected. this process was repeated by 3 observers. the pooled standard deviations of these 3 data sets was 1.21. determine the true mean force using all pooled data (with a 95% probability). the result should look like this: true mean = mean +/- margin of error

Answers: 1

continue

Physics, 22.06.2019 11:30, alupton4887

Arocket starts from rest and moves upward from the surface of the earth. for the first 10.0 s of its motion, the vertical acceleration of the rocket is given by ay = 12.80 m/s32t, where the +y-direction is upward. (a) what is the height of the rocket above the surface of the earth at t = 10.0 s? b) what is the speed of the rocket when it is 325 m above the surface of the earth?