Physics, 29.12.2020 14:00, smonahan2023

1.The geologic time scale divides time into years and centuries, true or false

Answers: 2

Show answers

Answers

answered: naomicervero

The answer is "False"

Explanation:

The geologic time scale is the "schedule" for occasions in Earth history. It partitions time into named units of unique time called in descending order of duration "eons, eras, periods, epochs, and ages". The specification of those geologic time units depends on stratigraphy, which is the relationship and order of rock layers. The fossil structures that happen in the stones, nonetheless, give the central methods for setting up a geologic time scale, with the circumstance of the development and vanishing of far and wide species from the fossil record being used to outline the beginnings and endings of ages,, periods, and different stretches.

Geologic time is the broad time period involved by the geologic history of Earth. Formal geologic time starts toward the beginning of the Archean Eon (4.0 billion to 2.5 billion years back) and proceeds to the current day.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

Look it up you feel me

Other questions on the subject: Physics

Physics, 21.06.2019 15:30, jungcoochie101

What defines the mass number of an isotope? a. the sum of the neutrons and protons b. the sum of the neutrons and electrons c. the number of neutrons d. the number of protons

Answers: 1

continue

Physics, 22.06.2019 04:30, MadisonUpky9652

Which of the following are not typically included in the periodic table? a. atomic mass b. element symbol c. isotopes d. number of electrons

Answers: 2

continue

Physics, 22.06.2019 11:50, taylorannsalazar

Select all that applywhat are some basic resources a family is expected to provide for children? educationclothesspending

Answers: 2

continue

Physics, 22.06.2019 15:00, tinagibbs98

10 points! will mark brainiest! in a heat engine if 1,000 j of heat enters the system and the piston does 500 j of work, what is the final internal energy of the system if the initial energy was 2,000 j 1: write the equation 2: list out your known variables 3: plug the numbers into the equations 4: solve 5: write your solution statement that includes initial energy and final energy added you so much!

Answers: 3

continue

Do you know the correct answer?

1.The geologic time scale divides time into years and centuries, true or false...