Physics, 10.12.2020 06:30, danny1687

Tony has a mass of 50 kg , and his friend Sam has a mass of 45 kg. Assume that both friends push off on their rollerblades with the same force. EXPLAIN which boy will have greater acceleration.

Answers: 3

Show answers

Answers

answered: Guest

3.2x10^7

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

Iagree c would be the answer

answered: Guest

Answerthe energy required is 1.60 × 10⁻¹⁸ j, to three significant figures.explanationwe define electric potential as the ratio electric potential energy to the charge, $v = \dfrac{e_p}{q}$ then the following gives us the potential difference, $\delta v = v_b - v_a$ $\begin{aligned} \delta v & = \dfrac{e_p_b}{q} - \dfrac{e_p_a}{q} \\ & = \dfrac{\delta e_p}{q} \end{aligned}$ the formula $\delta v = \delta e_p / q$ may be on your formula sheet.the change in electric potential energy would be the energy that would needed to move it from point a to point b. solving for that, we get $\delta e_p = q\delta v$ using q = 8.00 × 10⁻¹⁹ c and δv = 2.00 v, we get $\begin{aligned} \delta e_p & = (8.00\times10^{-19} \text{ c})(2.00\text{ v}) \\ & = 1.60\times 10^{-18}\text{ j} \end{aligned}$ the energy required is 1.60 × 10⁻¹⁸ j, to three significant figures.