Physics, 10.11.2020 17:00, organicmemez

If the same satellite orbited at the same velocity around a planet with three times the force of gravity, the orbit radius would be (multiplied, divided) by .

Answers: 1

Show answers

Answers

answered: potato3999

the orbit radius would be divided by 3

Explanation:

In order to orbit the planet, the centripetal force of satellite must balance the gravitational force between planet and satellite.

centripetal Force = Gravitational Force

(Ms)(V)²/r = (G)(Ms)(Mₓ)/r²

V² = GMₓ/r

where,

V = velocity of satellite

G = Gravitational Constant

Mₓ = Mass of Planet

r = orbit radius

but, G = gr²/Mₓ

Therefore,

V² = (Mₓ/r)(gr²/Mₓ)

V = √gr equation (1)

where,

g = force of gravity

Now, for change in force of gravity:

V' = √g'r'

where,

g' = 3g

V' = V

Therefore,

V = √3gr' equation (2)

Comparing equation (1) and equation (2), we get:

√gr = √3gr'

gr = 3gr'

r = 3r'

r' = r/3

Hence, the orbit radius would be divided by 3.

answered: Guest

t2 equal the displacement of the particle over the same time period if t2> t/2? hint: consider a sine wave starting at t1=0, then consider a closing wave starting at t1=0, for your explanatio

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 20:10, hncriciacheichi

Two cannon balls weighing 18 kg and 24 kg are chained together and fired horizontally with a velocity of 165 m/s from the top of a 21-m wall. the chain breaks during the flight of the cannonballs and the 18-kg cannonball strikes the ground at t = 1.5 s, at a distance of 240 m from the foot of the wall, and 7 m to the right of the line of fire. determine the position of the other cannonball at that instant. neglect the resistance of the air.

Answers: 1

continue

Physics, 22.06.2019 21:40, lottie2306

Engines for propeller-driven aircraft are limited in their maximum rotational speed by the fact that the tip speed of the propeller must not approach the speed of sound in air (mach i). taking 6 ft as a typical diameter for a propeller of a light airplane and 1100 fils as the speed of sound, find the upper limit on the rpm (revolutions per minute) of the propeller shaft.

Answers: 3

continue

Physics, 23.06.2019 04:31, MorgannJ

Do you think you could give me the answers to #29?

Answers: 2

continue

Physics, 23.06.2019 08:30, Brock2002

Aproper cool-down routine does which of the following? a). motivates you for your next workout b). the body adjust back to a resting state c). leaves you feeling worn-out d). strengthens muscles

Answers: 3

continue

Do you know the correct answer?

If the same satellite orbited at the same velocity around a planet with three times the force of gra...