Physics, 06.11.2020 08:00, gl0man

A student wishes to push a 10 kg wooden crate across a wood floor. What is the minimum horizontal force that would be required to start the crate moving?

Answers: 3

Show answers

Answers

answered: esquiveljadyn8054

11kg and or 11N

Explanation:

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

force is based upon mass and acceleration.the statement is not always true.

it can be explained from newton's second law of motion.

as per newton's second law of motion the rate of change of momentum is directly proportional to the applied force and takes place along the direction of force.

mathematically it can be written as -

$f\alpha \frac{dp}{dt}$

⇒ $f= k \frac{dp}{dt}$

here k is the proportionality constant whose value is 1.

$f=\frac{dp}{dt}$

$f= \frac{d[mv]}{dt}$

$f= m\frac{dv}{dt} +v\frac{dm}{dt}$

$f=ma+v\frac{dm}{dt}$ [a is the acceleration=dv/dt]

hence we see that force not only depends on mass and acceleration but also on velocity and rate of change of mass. force f will depend on mass and acceleration only when mass is constant.

hence the statement that force is based upon mass and acceleration is false.

Other questions on the subject: Physics

Physics, 22.06.2019 11:00, jackiemiranda2010

Although longitudinal waves can travel through all media types what is the disadvantage of this type of wave transmission? a) he efficiency of he wave transmission is greatly diminished as the media becomes less dense b) the oscillation of one set of particles has a huge impact on neighboring particles c) particles become too close together as they bump into each other making it more likely to hit other particles down the line

Answers: 2

continue

Physics, 22.06.2019 13:20, Jbutler15

This energy transformation diagram represents the energy of a skateboarder moving along a half-pipe. as she skates toward the top of the half-pipe, her original kinetic energy is converted to potential energy and friction. how much of the energy is potential?

Answers: 3

continue

Physics, 22.06.2019 19:30, alexmarche8637

Contains chemical energy. a. heat b. light c. natural gas

Answers: 2

continue

Physics, 22.06.2019 23:30, elizabethhubbe

Which statement correctly describes the interaction between magnetic poles? north and south poles attract each other. north and south poles repel each other. two north poles will attract each other. two south poles will attract each other.

Answers: 1

continue

Do you know the correct answer?

A student wishes to push a 10 kg wooden crate across a wood floor. What is the minimum horizontal fo...