Physics, 21.08.2020 20:01, kimhoss2

A bird flew 100 meters in 2 minutes. What was the birds speed ? (show all your work below)

Answers: 1

Show answers

Answers

answered: yoselinruiz

The speed of a bird that flies 100 meters in 2 minutes is 0.83 m/s.

The speed is a scalar magnitude defined as the quotient of the distance traveled and the time, as follows:

$s = \frac{d}{t}$

Where:

d: is the distance = 100 m

t: is the time = 2 min

Hence, the bird's speed is:

$s = \frac{d}{t} = \frac{100 m}{2 min} = 50 \frac{m}{min}*\frac{1 min}{60 s} = 0.83 m/s$

Therefore, the bird's speed is 0.83 m/s.

You can see another example of speed calculation here: link

I hope it helps you!

answered: rebeckas0102

speed = 50 metres/minute

Explanation:

Distance traveled = 100 metres

Time taken =- 2 minutes

Speed = $\frac{Distance }{Time}$

speed = $\frac{100}{2}$

speed = 50 metres/minute

A bird flew 100 meters in 2 minutes. What was the birds speed ? (show all your work below)

answered: Guest

wvbbvvv

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 19:30, elijaahstepp041

Which graph best represents the relationship between the electric current and the rate at which a magnet is turning inside an electric generator?

Answers: 3

continue

Physics, 22.06.2019 12:10, malikbryant2002

Consider a one meter long horizontal pipe with a constant 100 cm^2 cross sectional area. water flows rightward into the pipe at x = 0 with flow velocity 02m/sec at every point within the pipe intake area. at x=1, the rightward flow rate is 0.192 m/sec. assume the water is a conserved quantity in the pipe, so there must be a leak (a sink) somewhere in the pipe. 1. compute net volumetric flow of the source if the system to be in equilibrium. 2. now assume the pipe in the problem has no leaks. compute the net volumetric rate of change for the system.

Answers: 3

continue

Physics, 22.06.2019 13:00, Bbmonstr8279

What effects result when there is an impact between earth and an asteroid? check all that apply. a. massive flooding. b. extinction of many life forms. c.major earthquakes change in average global temperature. d. giant dust cloud

Answers: 3

continue

Physics, 22.06.2019 18:30, kennettahughley7964

Daughter element the new element produced along with a decay particle in a nuclear transmutation 2. half-life the substance that decays in a nuclear transmutation 3. parent element the change of one chemical element into another by nuclear decay or radioactive bombardment 4. transmutation the time required for the decay of one-half of the atoms in a sample of radioactive material

Answers: 2

continue

Do you know the correct answer?

A bird flew 100 meters in 2 minutes. What was the birds speed ? (show all your work below)...