Physics, 17.08.2020 04:01, andreamartinez7876

Three identical point charges, Q = 2 PC, are placed at the vertices of an equilateral triangle as shown in the figure. The length of each side of the triangle is d = 2 m. Determine the magnitude and direction of the total electrostatic force on the charge at the top of the triangle.

Answers: 1

Show answers

Answers

answered: emily743

The total force on the charge at the top of the triangle is approximately

$1.56\,\,10^{-14}\,\,N$

Explanation:

Please look at the attached image to follow the explanation.

Since all charges are of the same positive value, the force exerted on the top charge by the other two are going to be on the line that joins the top charge with each of the other vertices of the triangle, pointing away from the top charge (illustrated by green vectors of the same length in the image).

We need to find the x and y components of these force vectors in order to find the resultant force by combining the x components among themselves, and the y components among themselves. Notice that the angle needed is in all cases 60^o .

The x- components include the cosine of 60^o , while the y components include the sine of 60^o .

Notice as well that the x-components cancel each other (they have the same magnitude but point in opposite directions), while the y-components are both of the same value but pointing in the same direction (pointing up).

Then we just need to multiply by two the y component of one of the forces to find this total force.

Now, the magnitude of the forces in question are given by Coulomb's Law:

$F_C=k\,\frac{q_1\,\,q_2}{d^2} =9\,\,10^9\,\frac{2\,\,10^{-12}\,\,2\,\,10^{-12}}{2^2} =9\,\,10^{-15}\,\,N$

therefore we can calculate what the y-component of this is using:

$F_y=F\,sin(60^o)=9\,\,10^{-15} \,\frac{\sqrt{3} }{2} \\$

and twice this value becomes:

$2\, \,F_y=(2)\,\,9\,\,10^{-15} \,\frac{\sqrt{3} }{2}=9\,\,\sqrt{3} \,\,10^{-15}\approx 1.56\,\,10^{-14}\,\,N$

Three identical point charges, Q = 2 PC, are placed at the vertices of an equilateral triangle as sh

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

another example of kinetic energy would be,

kinetic energy > moving energy

answer > letter choice (c), a hammer falling off a table.

hope that ! : )

Other questions on the subject: Physics

Physics, 22.06.2019 01:00, muhammadcorley123456

4. who was the first one to measure the speed of light and conclude that it is finite? 5. who was the first philosopher who thought the speed of light is finite? 13. what is the speed of light numerically? 14. give an example of something moving faster than light 15. give an example for some particles or waves that

Answers: 1

continue

Physics, 22.06.2019 10:30, alwaysneedhelp8420

If y gets smaller as x gets bigger and y have an relationship?

Answers: 1

continue

Physics, 22.06.2019 11:30, animaljamissofab

Acaterpillar tries to climb straight up a wall a meter high, but for every 2 cm up it climbs, it slides down 1 cm. eventually, it reaches the top. when it reaches the top, it does not pull itself over so it will slide down 1 cm. what is the total displacement traveled?

Answers: 3

continue

Physics, 23.06.2019 06:30, deebroussard

Pl i beg u so much now propane burns in oxygen to produce carbon dioxide and steam. the unbalanced equation for this reaction is: c3h8 + o2 → co2 + h2o use coefficients to balance this equation. a) c3h8 + 3 o2 → 3 co2 + 4 h2o b) c3h8 + o2 → 3 co2 + 4 h2o c) c3h8 + 5 o2 → 3 co2 + 4 h2o d) 2 c3h8 + 5 o2 → 3 co2 + 4 h2o

Answers: 1

continue

Do you know the correct answer?

Three identical point charges, Q = 2 PC, are placed at the vertices of an equilateral triangle as sh...