Physics, 23.07.2020 15:01, rileyeddins1010

A toboggan is sliding down an icy slope. As it goes down, does work on the toboggan and ends up converting energy to energy.

Answers: 2

Show answers

Answers

answered: 61497

As it goes down, weight does work on the toboggan and it ends up converting gravitational potential energy to kinetic energy.

1. weight

2. gravitational potential energy to kinetic energy.

Explanation:

As it goes down, weight does work on the toboggan and it ends up converting gravitational potential energy to kinetic energy.

work done by toboggan = weight × distance

W = mg and the distance is down the icy slope

By using law of conservation of energy, energy can neither be created nor destroyed, but can be conserve from one form to another in a closed system.

Toboggan converts gravitational potential energy (mgh) to kinetic energy(¹/₂mv²)

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

float.

archimedes' principle

denser than water sinks in water.

denser than mercury would sink in it

Other questions on the subject: Physics

Physics, 22.06.2019 05:30, salma1018

Imagine that someone pushes one marble toward a motionless marble. would there still be action-reaction forces involved in the collision? how might the marbles’ motions be changed? ?

Answers: 1

continue

Physics, 22.06.2019 14:30, willoughbysierra

The man of mass m1 and the woman of mass m2 are standing on opposite ends of the platform of mass m0 which moves with negligible friction and is initially at rest with s = 0. the man and woman begin to approach each other. derive an expression for the displacement s of the platform when the two meet in terms of the displacement x1 of the man relative to the platform.

Answers: 1

continue

Physics, 22.06.2019 15:30, bloodry

Two point charges are separated by a certain distance. how does the strength of the electric field produced by the first charge, at the position of the second charge, change if the second charge is doubled? a. the field does not change b. the field strength decreases by half. c. the field strength doubles d. the field strength quadruples

Answers: 1

continue

Physics, 22.06.2019 16:30, 21cassitsh

The total amount of energy contained in an object

Answers: 3

continue

Do you know the correct answer?

A toboggan is sliding down an icy slope. As it goes down, does work on the toboggan and ends up con...