Physics, 15.07.2020 02:01, jayleneeurich

A single-turn circular loop of radius 6 cm is to produce a field at its center that will just cancel the earth's field of magnitude 0.7 G directed at 70 below the horizontal north direction. Find the current in the loop.

Answers: 3

Show answers

Answers

answered: miami158999

The current is $I = 6.68 \ A$

Explanation:

From the question we are told that

The radius of the loop is $r = 6 \ cm = 0.06 \ m$

The earth's magnetic field is $B_e = 0.7G= 0.7 G * \frac{1*10^{-4} T}{1 G} = 0.7 *10^{-4} T$

The number of turns is N =1

Generally the magnetic field generated by the current in the loop is mathematically represented as

$B = \frac{\mu_o * N * I}{2 r }$

Now for the earth's magnetic field to be canceled out the magnetic field generated by the loop must be equal to the magnetic field out the earth

B = B_e

=> $B_e = \frac{\mu_o * N * I }{ 2 * r}$

Where $\mu$ is the permeability of free space with value $\mu _o = 4\pi * 10^{-7} N/A^2$

$0.7 *10^{-4}= \frac{ 4\pi * 10^{-7} * 1 * I}{2 * 0.06}$

=> $I = \frac{2 * 0.06 * 0.7 *10^{-4}}{ 4\pi * 10^{-7} * 1}$

$I = 6.68 \ A$

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

no simpler subs form complex ones. synthesise = make

Other questions on the subject: Physics

Physics, 21.06.2019 21:50, jferdi2005

When applying kirchhoff's rules, one of the essential steps is to mark each resistor with plus and minus signs to label how the electric potential changes from one end of the resistor to the other. the circuit in the drawing contains four resistors, each marked with the associated plus and minus signs. however, one resistor is marked incorrectly. which one is it?

Answers: 1

continue

Physics, 22.06.2019 10:00, chaseashley24

** urgent** the voltage across the primary winding is 350,000 v, and the voltage across the secondary winding is 17,500 v. if the secondary winding has 600 coils, how many coils are in the primary winding? a- 30 coilsb- 583 coilsc- 12,000 coilsd- 332,500 coils

Answers: 1

continue

Physics, 22.06.2019 14:30, uwunuzzles

Lightning is an example of what phenomenon? a release of a large amount of energyan absorption of a large amount of energya natural electric circuita natural electric current

Answers: 1

continue

Physics, 22.06.2019 18:00, hannacarroll2539

Athin nonconducting rod with a uniform distribution of positive charge q is bent into a circle of radius r. the central perpendicular axis through the ring is a z-axis, with the origin at the center of the ring. a) what is the magnitude of the electric field due to the rod at z = 0? n/c (b) what is the magnitude of the electric field due to the rod at z = infinity? n/c (c) in terms of r, at what positive value of z is that magnitude maximum? r (d) if r = 4.00 cm and q = 9.00 µc, what is the maximum magnitude? n/c

Answers: 1

continue

Do you know the correct answer?

A single-turn circular loop of radius 6 cm is to produce a field at its center that will just cancel...