Physics, 06.05.2020 23:19, austind9027

A circular coil consists of N = 410 closely winded turns of wire and has a radius R = 0.75 m. A counterclockwise current I = 2.4 A is in the coil. The coil is set in a magnetic field of magnitude B = 1.1 T. The magnetic field points to right

Answers: 2

Show answers

Answers

answered: caitlyn79

The complete question is;

A circular coil consists of N = 410 closely winded turns of wire and has a radius R = 0.75 m. A counterclockwise current I = 2.4 A is in the coil. The coil is set in a magnetic field of magnitude B = 1.1 T.

a. Express the magnetic dipole moment μ in terms of the number of the turns N, the current I, and radius

b. Which direction does μ go?

A) μ = 1738.87 A.m²

B) The direction of the magnetic moment will be in upward direction.

Explanation:

We are given;

The number of circular coils;

N = 410

The radius of the coil;R = 0.75m

The current in the coils; I = 2.4 A

The strength of magnetic field;

B =1.1T

The formula for magnetic dipole moment is given as;

μ = NIA

Where;

N is number of turns

I is current

A is area

Now, area; A = πr²

So, A = π(0.75)²

Thus,plugging in relevant values, the magnetic dipole moment is;

μ = 410 * 2.4 * π(0.75)²

μ = 1738.87 A.m²

B) According to Fleming's right hand rule, the direction of the magnetic moment comes out to be in upward direction.

answered: Guest

the average speed is 24.57 km/hr

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o