Physics, 23.04.2020 04:32, sbhunsaker9025

1) How many AU make up a light-year?

2) What ia an astronomical unit (AU) in miles and kilometers? Why is it useful for understanding the distances to planets?

Answers: 2

Show answers

Answers

answered: jennyferalbarracin64

1) 63241 AU make a light year.

2) $1.495x10^{8}km$ , 92914853miles

The astronomical unit gives a simple way to compare distance between planets and the Sun, using the distance from the Sun to Earth as an started point.

Explanation:

1) How many AU make up a light-year?

A light year is the distance that light can travel in one year

The speed of light has a value of $3x10^{8}m/s$

That can be express in units of kilometers and years:

$3x10^{8}m/s \cdot \frac{1km}{1000m}$ -- $300000km/s \cdot \frac{31536000s}{1year}$ -- $9.4608x10^{12}Km/year$

Therefore, the distance can be found by means of the equation for average velocity.

$v = \frac{x}{t}$

$x = v \cdot t$ (2)

Then, t will be equal to 1 year ( t = 1 year )

$x = (9.4608x10^{12}Km/year)(1year)$

$x = 9.4608x10^{12}Km$

However, an astronomical unit is defined as the distance between the Earth and the Sun ( $1.495x10^{8]km$ ).

Therefore, to know how many astronomical units make a light year:

$\frac{9.4608^{12}km}{149597870km} = 63241$

Hence, 63241 AU make a light year.

2) What is an astronomical unit (AU) in miles and kilometers? Why is it useful for understanding the distances to planets?

As in was already said, an astronomical unit has a value of $1.495x10^{8]km$

Then, it can be express in units of miles:

$1.495x10^{8}km \frac{1mile}{1609km}$ ⇒ 92914853miles

The astronomical unit gives a simple way to compare distance between planets and the Sun, using the distance from the Sun to Earth as an started point.

answered: Guest

hotter stars = bluer stars

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 23:20, ElizabethF

Asmall, positively charged ball is moved close to a large, positively charged ball. which describes how the small ball likely responds when it is released? it will move toward the large ball because like charges repel. it will move toward the large ball because like charges attract. it will move away from the large ball because like charges repel. it will move away from the large ball because like charges attract.

Answers: 3

continue

Physics, 22.06.2019 00:30, Waakkaa

Glass is transparent to visibile light under normal conditions; however, at extremely high intensities, glass will absorb most of the light incident upon it. this works through a process known as multiphoton absorption. in this process, several photons are absorbed at the same time. if very intense light whose photons carry 2ev of energy is shined onto a material with a band gap of 4ev, that light can be absorbed through two-photon absorption, because two photons have the right amount of energy to bridge the band gap. what is the minimum number of photons of 800-nm light that are needed to equal or exceed the band gap of fused silica glass

Answers: 1

continue

Physics, 22.06.2019 02:10, CrownedQueen

"an open tank has the shape of a right circular cone. the tank is 6 feet across the top and 5 feet high. how much work is done in emptying the tank by pumping the water over the top edge? note: the density of water is 62.4 lbs per cubic foot."

Answers: 2

continue

Physics, 22.06.2019 03:30, MK100

When a spring is compressed, the energy changes from kinetic to potential. which best describes what is causing this change? work power gravitational energy chemical energy

Answers: 3

continue

Do you know the correct answer?

1) How many AU make up a light-year?

2) What ia an astronomical unit (AU) in miles and...