Physics, 20.04.2020 20:15, Madsissabell

An object is thrown with a horizontal velocity of 20 m/s from a cliff that is 125 m above level ground. If air resistance is negligible, the time that it takes the object to fall to the ground from the cliff is most nearly

Answers: 3

Show answers

Answers

answered: kyleigh85

The time taken for the object to fall to the ground is 5 s

From the question given above, the following data were obtained:

Horizontal velocity (u) = 20 m/sHeight (h) = 125 mAcceleration due to gravity (g) = 10 m/s²Time (t) =?

The time taken for the object to fall to the ground can be obtained as follow:

$t = \sqrt{ \frac{2h}{g}} \\ \\ t = \sqrt{ \frac{2 \times 125}{10}} \\ \\ t = 5 \: s \\ \\$

Therefore, the time taken for the object to get to the ground is 5 s

Learn more about projectile motion: link

answered: rorob

Given that,

Horizontal velocity of the object, v = 20 m/s

Height of the cliff, h = 125 m

We need to find the time that it takes the object to fall to the ground from the cliff is most nearly. It can be calculated using second equation of motion. Let us consider that the initial speed of the object is 0. So,

$h=ut+\dfrac{1}{2}at^2$

Here, a = g and u = 0

$h=\dfrac{1}{2}at^2\\\\t=\sqrt{\dfrac{2h}{g}} \\\\t=\sqrt{\dfrac{2\times 125}{10}} \\\\t=5\ s$

So, the object will take 5 seconds to fall to the ground from the cliff.

answered: Guest

Ifound this on google “your outer ear collects sound waves and reflects them into a tiny tube called the ear canal. at the end of the ear canal is a thin, skin-like membrane stretched tightly over the opening, called the eardrum.” i hope this you for what your looking for

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 21.06.2019 21:30, gabrielolivas59

The earth remains in orbit around the sun due to the force of gravity. how does the force of gravity exerted by the sun on the earth compare to the force of gravity exerted by the earth on the sun?

Answers: 1

continue

Physics, 22.06.2019 00:00, madskate9993

During physical science, ms. greene challenged her students to produce an energy transformation. james and jill wrapped a 4-inch nail with a coil of fifty turns of wire. they connected one end of the coil to one terminal of a knife switch. they connected the other terminal of the knife switch to the battery. finally, they connected the end of the coil to the other terminal of the battery. james held the tip of a 1-inch nail near the flat end of the 4-inch nail. jill closed the knife switch quickly and then opened it. the 1-inch nail was pulled toward the 4-inch nail. what is the best explanation of why the nail moved? a) electrical energy was converted to mechanical energy in the 1-inch nail. b) the 4-inch nail became an electromagnet and the magnetic force attracted the 1-inch nail. c) the electric current in the 4-inch nail was converted to mechanical energy in the 1-inch nail. d) the 4-inch nail had a positive charge and the 1-inch nail had a negative charge. opposites attracted.

Answers: 1

continue

Physics, 22.06.2019 04:00, vanessa2002584

What is the scientific definition of energy that relates to work

Answers: 1

continue

Physics, 22.06.2019 14:30, shwubblz

Exercise 2. find the wavelength of a photon emitted when an electron jumps from the n = 3 energy level down to the n = 2 energy level. where is this photon in the electromagnetic spectrum?

Answers: 3

continue

Do you know the correct answer?

An object is thrown with a horizontal velocity of 20 m/s from a cliff that is 125 m above level grou...