Physics, 26.03.2020 22:01, alexandriasmith727

A frictionless piston–cylinder device contains 7 kg of nitrogen at 100 kPa and 250 K. Nitrogen is now compressed slowly according to the relation PV1.4 = constant until it reaches a final temperature of 450 K. Calculate the work input during this process. The gas constant for nitrogen is R = 0.2968 kJ/kg·K.

Answers: 2

Show answers

Answers

answered: edtorres5

-1038.8 kJ

Explanation:

From the question, we can see that PV^n = constant. And as such, we can deduce that it is a polytropic process. Thus, we can use the polytropic work equation to calculate the needed work input.

from the question we were given

Mass of nitrogen, m = 7kg

initial temperature, T1 = 250k

Final temperature, T2 = 450k

Polytropic index, n = 1.4

Specific gas constant, R = 0.2968kJ/kgK

W = [p2 * v2 - p1 * v1] / 1 - n

W = [m * R * T2 - T1] / 1 - n

W = 7*0.2968*(450 - 250)] / 1 - 1.4

W = [7*0.2968*200] / -0.4

W = 415.52 / -0.4

W = -1038.8 kJ

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

not moving. pos accel,

The position-time graph describes the motion of a moving object. describe the motion represented by

Other questions on the subject: Physics

Physics, 22.06.2019 05:30, dashawn3rd55

Mutt and jeff are running along a path each pushing a cart loaded with rocks. if mutt's wagon has a mass two times greater than jeff's and they want to stay together, arriving at their destination at the same time, what must happen? a) jeff should slow down so mutt can catch up. b) mutt must use half as much force to push his cart. c) mutt must use twice as much force to push his cart. d) mutt and jeff will use the same force, but mutt will take bigger steps.

Answers: 1

continue

Physics, 22.06.2019 16:30, makennahudson94

In the nineteenth century, gregor mendel first determined some basic rules of genetics that have been observed throughout all types of life. no observations have disproved these basic rules of genetics. charles darwin developed the idea of biological evolution around the same time, but he was unaware of mendel’s discoveries in genetics. over a century later, darwin’s idea of evolution was modified in order to incorporate mendel’s rules of genetics along with the other evidence that darwin had used. what is most likely the relationship between mendel’s rules of genetics and darwin’s idea of biological evolution? a.)mendel’s genetics states laws that are now part of the theory of biological evolution. b.)biological evolution states laws that are part of mendel’s theory of genetics. c.)mendel’s genetics replaced darwin’s entire concept of biological evolution. d.)biological evolution is a law that explains why all genetics exist.

Answers: 1

continue

Physics, 22.06.2019 20:50, isarahweller103

Suppose that a mass of 2 kg is attached a spring whose spring constant is 50. the system is damped such that b = 12 . the mass is set in motion with an initial velocity of -8 m/s at a position 0 meters from equilibrium. set up and solve a differential equation that models this motion. write your solution in the form a cos ( ω t − α ) where α is a positive number. use your solution to fill in the information below: what is the amplitude of the motion? what is the value of ω ? what is the phase shift?

Answers: 1

continue

Physics, 23.06.2019 00:00, jeffro198004

You notice the birds sitting on the electrical wires which of the following explain why the birds don't get shocked

Answers: 2

continue

Do you know the correct answer?

A frictionless piston–cylinder device contains 7 kg of nitrogen at 100 kPa and 250 K. Nitrogen is no...