Physics, 06.03.2020 22:34, Neishab932

A 270-kg flatcar 28 m long is moving with a speed of 7.0 m/s along horizontal frictionless rails. A 95-kg worker starts walking from one end of the car to the other in the direction of motion, with speed 1.5 m/s with respect to the car. In the time it takes for him to reach the other end, how far has the flatcar moved?

Answers: 1

Show answers

Answers

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

d₁ = displacement of tern from arctic to antarctic = 11000 miles

d₂ = displacement of tern from antarctic to arctic = - 11000 miles

d = total displacement for the journey

total displacement for the journey is given as

d = d₁ + d₂

d = 11000 + (-11000)

d = 0 miles

t₁ = time of travel from arctic to antarctic = 3 months = 3 x 30 days = 90 days

t₂ = time of travel from antarctic to arctic = 3 months = 3 x 30 days = 90 days

t = total time of travel

total time of travel is given as

t = t₁ + t₂

t = 90 + 90

t = 180 days

average velocity is given as

average velocity = total displacement/ total time

v = d/t

v = 0/180

v = 0 miles/day

answered: Guest

where is the photo and the answer choices?

answered: Guest

5.5 n====== $\sum f = ma$ assuming that $\sum f = f_{app}$ we have m = 0.145 kg a = 38 m/s²therefore $f_{app} = (0.145\text{ kg})(38\text{ m/s}^2) = 5.51\text{ n}$ 5.51 n, but two significant figures.final answer: 5.5 n

Other questions on the subject: Physics

Physics, 22.06.2019 04:20, gonzalesalexiaouv1bg

When considering gravity acceleration and the force of acceleration, what must be true? a. the direction of acceleration must be perpendicular to the direction of the force. b. the direction of the force and the direction of acceleration must be the same as each other. c. the direction of the force and the direction of acceleration must be opposite of each other. d. the mass of the body must be the same as the acceleration of the body.

Answers: 1

continue

Physics, 22.06.2019 09:00, carterh166

Immediately upon reaching its lowest point, a falling pendulum bob has its greatest amount of energy, which is the initial amount of potential energy. a. heat; less than b. heat; more than c. kinetic; less than d. kinetic; more than

Answers: 3

continue

Physics, 22.06.2019 11:30, jacob12049

If the textbook weighs 19.6 newtons on venus, what is the strength of gravity on venus?

Answers: 1

continue

Physics, 22.06.2019 13:10, ovebrown

Most short-period comets do not have randomly oriented orbits because

Answers: 2

continue

Do you know the correct answer?

A 270-kg flatcar 28 m long is moving with a speed of 7.0 m/s along horizontal frictionless rails. A...