Physics, 02.03.2020 19:09, Harini5721

3.A rocket, initially at rest, is fired vertically with an upward acceleration of 10 m/s2 . At an altitude of 0.50 km, the engine of the rocket cuts off. What is the maximum altitude it achieves?

Answers: 3

Show answers

Answers

answered: madelynreynolds4757

The maximum altitude reached, measured from the point where the engine shuts off = 0.510 km

The maximum altitude reached measured from the ground = 0.5 + 0.510 = 1.01 km

Explanation:

We will use the equations of motion to analyse this motion.

When the rocket is fired from the ground,

u = initial velocity = 0 m/s (since it was initially at rest)

a = 10 m/s²

The engine cuts off at y = 0.5 km = 500 m

The velocity at that point = V

v² = u² + 2ay

v² = 0² + 2(10)(500) = 10000

v = 100 m/s

The velocity at this point serves as the initial velocity for the next phase of the motion

u = 100 m/s

v = final velocity = 0 m/s (at maximum height, velocity = 0)

y = vertical distance travelled after the engine shuts off beyond 0.5 km = ?

g = acceleration due to gravity = - 9.8 m/s²

v² = u² + 2gy

0 = 100² + 2(-9.8)(y)

- 19.6 y = - 10000

y = 510.2 m = 0.510 km

So, the maximum altitude reached with respect to the ground = 0.5 + 0.510 = 1.01 km

answered: Guest

answer: b.

explanation:

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 14:30, lizzie3545

Aweight lifter raises a 1600 n barbell to a height of 2.0 meters. how much work was done? w = fd a) 30 joules b) 3000 joules c) 320 joules d) 3200 joules

Answers: 2

continue

Physics, 22.06.2019 16:00, ewymer3901

Why does lightning travel from clouds to the ground?

Answers: 2

continue

Physics, 22.06.2019 16:50, lizzepacheco

Acommercial refrigerator with refrigerant-134a as the working fluid is used to keep the refrigerated space at -35°c by rejecting waste heat to cooling water that enters the condenser at 18°c at a rate of 0.25 kg/s and leaves at 26°c. the refrigerant enters the condenser at 1.2 mpa and 50°c. if the compressor consumes 3.3 kw of power, determine (a) the mass flow rate of the refrigerant, (b) the refrigeration load, (c) the cop, and (d) the minimum power input to the compressor for the same refrigeration load.

Answers: 2

continue

Physics, 22.06.2019 18:20, miner12924owhu4d

Awave with a frequency of 500 hz is traveling at a speed of 100 m/s. what is the wavelength?

Answers: 1

continue

Do you know the correct answer?

3.A rocket, initially at rest, is fired vertically with an upward acceleration of 10 m/s2 . At an al...