Physics, 29.02.2020 23:09, dannyhouseman55

The emf produced in a generator is Vemf = 25 sin 377t. What is the frequency of rotation of the circular coil?

50 Hz
60 Hz
25 Hz
15 HZ

Answers: 3

Show answers

Answers

answered: s61371

Explanation:

The emf produced in a generator is:

Vemf=25sin(377t)

Recall the standard equation which describes relation between amplitude and angular velocity.

V=asin(ωt)

so substitute the numbers into the equation

Vemf=25sin(377)

to find frequency use the equation

f=w/2π

so freq= 377/2π

this will equal 60Hz

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

note: the given question is incomplete.

complete question is given below.

which is an example of kinetic energy?

a. the energy stored in ethanol

b. a hockey puck sliding across the ice

c. a compressed spring

d. a ball sitting at the top of a ramp

solution: the kinetic energy is the energy posses by the virtue of the motion of the object.

in the given options, a, c and d are the example of potential energy because it is the energy posses by the virtue of the rest of the object. but option b has the kinetic energy as the object is in motion.

hence, a hockey puck sliding across the ice is the apex example of kinetic energy.

so, the option (b) a hockey puck sliding across the ice is the correct option.

Other questions on the subject: Physics

Physics, 21.06.2019 15:00, darius12318

List one type of erosion and describe how it happens?

Answers: 1

continue

Physics, 21.06.2019 19:30, Fangflora3

11. you want to calculate the displacement of an object thrown over a bridge. using -10 m/s2 for acceleration due to gravity, what would be the total displacement of the object if it took 8 seconds before hitting the water?

Answers: 1

continue

Physics, 22.06.2019 20:30, sza2016

This is a form of winter precipitation. it is frozen precipitation falling as ice pellets. snowflakes melt into raindrops as they pass through a thin layer of warmer air. the raindrops then refreeze into particles of ice when they fall into a layer of sub-freezing air near the surface of the earth. this precipitation is called a) hail. b) rain. c) sleet. d) snow.

Answers: 1

continue

Physics, 23.06.2019 00:10, alisonnn101

During cooling, the kinetic energy of the molecules falls. why does this happen? a. the motion of the molecules increases. b. the motion of the molecules slows down. c. the van der waals forces between molecules decrease d. the forces of attraction between the molecules are overcome.

Answers: 2

continue

Do you know the correct answer?

The emf produced in a generator is Vemf = 25 sin 377t. What is the frequency of rotation of the circ...