Physics, 20.02.2020 19:15, minerrage43

Select the correct locations on the image. Identify the charges that are neagtive.

A, B, C, or D.
You can have more than 1 clicked at a time

Select the correct locations on the image. Identify the charges that are neagtive.A, B, C, or D.You

Answers: 1

Show answers

Answers

answered: mashejaj

Negative charges: B and C

Explanation:

The electric field produced by a single point charge has a radial shape and decreases as we move away from the charge, following an inverse square law.

The direction of the field depends on the sign of the charge. In particular:

- If the charge is positive, the electric field is outward - so the field lines point away from the charge

- If the charge is negative, the electric field is inward - so the field lines point toward the charge

Therefore in this image, in order to identify the negative charges, we have to identify the charges that have field lines pointing towards them.

So we have:

- In the figure on top, field lines go away from charge A and towards charge B --> so charge B is negative

- In the figure on bottom, field lines go away from charge D and towards charge C --> so charge C is negative

Therefore, the negative charges are B and C.

answered: Guest

technology is the collection of techniques, skills, methods, and processes used in the the merriam-webster learner's dictionary offers a definition of the term: "the use of moreover, these technologies have become so complex that entire fields more recently, modern works of science fiction such as those by philip k.

explanation:

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o