Physics, 12.02.2020 18:55, JellalFernandes

When a car traveling at 30 m/s hits the gas pedal, it speeds up to 65 m/s in 3.5 seconds. What is the car's
acceleration during that time?
A. 5 m/s
C. 10 m/s
B. 15 m/s
D. 20 m/s

Answers: 1

Show answers

Answers

answered: lele2010

The car gets accelerated to 10 m/s² to reach the final velocity of 65 m/s from 30 m/s in 3.5 seconds.

Option C.

Explanation:

Acceleration is the ratio of change in velocity to the time taken to reach the final velocity. As here the initial velocity of car is given as 30 m/s and the final velocity is given as 65 m/s. So to reach this final velocity the car is taking a time of 3.5 seconds.

Thus, acceleration = change in velocity/Time

Acceleration = (65-30)/3.5 = 10 m/s²

So the car gets accelerated to 10 m/s² to reach the final velocity of 65 m/s from 30 m/s in 3.5 seconds.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

The next element is345640

Other questions on the subject: Physics

Physics, 22.06.2019 15:30, anonymous1813

What is the increase in density of a medium due to wave travel?

Answers: 2

continue

Physics, 22.06.2019 16:00, brooke0713

A( developed during the process of technology design

Answers: 3

continue

Physics, 22.06.2019 16:30, makenahbriana

In a heat engine if 1000 j of heat enters the system and the piston does 500j of work, what is the final internal energy of the system if the inital energy was 2000 j1.write the equation2.list out your known variables 3. plug the numbers into the equations4.solve 5.write your solution statement that includes initial energy and final energy added.

Answers: 3

continue

Physics, 23.06.2019 00:00, elyssa34972

Examine the drawing of a molecule. each ring represents an atom of nitrogen (n). what’s the chemical formula of this substance?

Answers: 2

continue

Do you know the correct answer?

When a car traveling at 30 m/s hits the gas pedal, it speeds up to 65 m/s in 3.5 seconds. What is th...