Physics, 20.11.2019 05:31, spazzinchicago

Atraveler pulls on a suitcase strap at an angle 36° above the horizontal. if of work are done by the strap while moving the suitcase a horizontal distance of what is the tension in the strap?

Answers: 3

Show answers

Answers

answered: shimohsen

Tension, T = 74.82 N

Explanation:

It is given that,

Angle between the suitcase and horizontal, $\theta=36^{\circ}$

Work done, W = 908 J (let)

Distance covered, d = 15 m (let)

We know that the work done by an object is given by the formula as :

$W=Fd\ cos\theta$

here, F = T

$W=Td\ cos\theta$

$T=\dfrac{W}{d\ cos\theta}$

$T=\dfrac{908}{15\times cos(36)}$

T = 74.82 N

So, the tension in the strap is 74.82 N. Hence, this is the required solution.

answered: ICAMARON632

74.79N

Explanation:

The question is incomplete. Here is the complete question.

" A traveler pulls on a suitcase straps at an angle 36° above the horizontal. If 908J of work are done by the strap while moving the suitcase a a horizontal distance of 15m, what is the tension in the strap?"

Work is said to be done if an applied force cause an object to move through a distance.

Work done = Force F × perpendicular distance d

Since the strap is pulled at ana angle above the horizontal,

Work done = F ×d cos(theta)

Given workdone = 908Joules

d = 15m

theta = 36°

908 = F × 15cos36°

F = 908/15cos36°

F = 908/12.14

F = 74.79N

The tension in the strap = 74.79N

answered: Guest

if the thermos has a vacuum innner, then heat through conv currents and conduction are reduced = vacuum flask

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o