Asled is being held at rest on a slope that makes an angle θ with the horizontal. after the sled is released, it slides a distance d1 down the slope and then covers the distance d2 along the horizontal terrain before stopping. find the coefficient of kinetic friction μk between the sled and the ground, assuming that it is constant throughout the trip.

mu_k =d_{1}\frac{{\sin}\left({\theta}\ri ght)}{\left(d_{2}+d_{1}{\cos}\left( {\theta}\right)\right)} (this is correct! )
suppose the same sled is released from the same height on the same slope. this time, however, assume that the coefficient of kinetic friction between the ground and the sled is a known quantity, mu, and, as before, constant throughout the trip. after the sled is released, it slides the same distance d_1 down the slope and then moves a certain (unknown) distance along the horizontal terrain before stopping. find the distance d traveled by the sled from the end of the slope until it comes to a stop.

express your answer in terms of the variables d_1, mu, and theta.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o