Physics, 15.10.2019 01:30, sarah192002

Afather demonstrates projectile motion to his children by placing a pea on his fork's handle and rapidly depressing the curved tines, launching the pea to heights above the dining room table. suppose the pea is launched at 7.39 m/s at an angle of 69.0° above the table. with what speed (in m/s) does the pea strike the ceiling 1.90 m above the table?

Answers: 3

Show answers

Answers

answered: hntnhtthnyt

4.17 m/s

Explanation:

To solve this problem, let's start by analyzing the vertical motion of the pea.

The initial vertical velocity of the pea is

$u_y = u sin \theta = (7.39)(sin 69.0^{\circ})=6.90 m/s$

Now we can solve the problem by applying the suvat equation:

v_y^2-u_y^2=2as

where

v_y is the vertical velocity when the pea hits the ceiling

a=g=-9.8 m/s^2 is the acceleration of gravity

s = 1.90 is the distance from the ceiling

Solving for v_y ,

$v_y = \sqrt{u_y^2+2as}=\sqrt{(6.90)^2+2(-9.8)(1.90)}=3.22 m/s$

Instead, the horizontal velocity remains constant during the whole motion, and it is given by

$v_x = u cos \theta = (7.39)(cos 69.0^{\circ})=2.65 m/s$

Therefore, the speed of the pea when it hits the ceiling is

$v=\sqrt{v_x^2+v_y^2}=\sqrt{2.65^2+3.22^2}=4.17 m/s$

answered: Guest

i dont know but

explanation:

whoever your teacher is, deserves a raise for using pokemon as an example

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Other questions on the subject: Physics

Physics, 22.06.2019 07:00, luisr0754

Critical mass is the of material required to produce a chain reaction. a.) minimum amount b.) atomic mass c.) precise amount d.) maximum amount

Answers: 1

continue

Physics, 22.06.2019 10:00, starsinopoli13

How are the crust and the inner core alike? a) they are both solid. b) they both have the same temperature. c) they are both under the same pressure. d) they are both very close to the center of the earth.

Answers: 1

continue

Physics, 22.06.2019 10:30, legendman27

You are given two vectors a⃗ =−3.00ι^ 5.00j^ and b⃗ =5.00ι^ 2.00j^. let the counterclockwise angles be positive.

Answers: 3

continue

Physics, 22.06.2019 11:30, georgesarkes12

1. a camcorder has a power rating of 19 watts. if the output voltage from its battery is 7 volts, what current does it use?answer units 2. a 1.5m wire carries a 6 a current when a potential difference of 57 v is applied. what is the resistance of the wire? your

Answers: 2

continue

Do you know the correct answer?

Afather demonstrates projectile motion to his children by placing a pea on his fork's handle and rap...