Physics, 05.10.2019 09:01, kie1148

A-3.25 consider a naca 2415 airfoil section in a low-speed wind tunnel. assume re 9 x 106 a) what is the zero-lift angle of attack? b) does this airfoil have negative or positive camber? c) what is the stalling angle of attack? d) what is the maximum value of ci? e) what is the lift-curve slope?

Answers: 2

Show answers

Answers

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

beta is electron from nucleus

something from nucleus has changed, but charge must be same for cons of charge

answered: Guest

the minimum constant speed at which she can catch the train is 2.7 m/s

given:

acceleration = 0.6 $\frac{m}{s^{2} }$

time = 4.5 s

to find:

velocity = ?

formula used:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

solution:

from 1st kinematic equation we get,

v = u + at

u = initial speed of train = 0 m/s

v = final speed of the train

a = acceleration of the train

t = time

v = 0 + (0.6 × 4.5)

v = 2.7 m/s

the minimum constant speed at which she can catch the train is 2.7 m/s

answered: Guest

total distance/total time

(85 + 82)/(5+3)

167/8

20 just over

Other questions on the subject: Physics

Physics, 22.06.2019 03:50, cyberdac01

Which statement correctly describes a step-up transformer? a. it increases the amount of electric energy available. b. it increases the voltage of an electric current. c. it changes direct current into alternating current. d. it has more loops of wire in its primary coil.

Answers: 1

continue

Physics, 22.06.2019 10:30, jadenp23

Which two particles are found in the center of an atom

Answers: 1

continue

Physics, 22.06.2019 14:00, tiny2007

Which body part transports oxygen removes waste materials in carries nutrients to the body as part of the circulatory system

Answers: 1

continue

Physics, 22.06.2019 15:30, anahitrejo1

1kg of water needs to recieve 4200j of energy to go from 90 degrees to 91 degrees. what is the specific heat capacity of water? what are the units?