The state of the atomic electron is usually described by a wave function «nlm. briefly explain what each of n, l, and m are and state which values each can take. why are they called good quantum numbers? (ii) the atomic electron in its ground state is described by the wave function v 100 = 3/2 e9 erlag 9: " 2 show that this wave function is normalized. calculate the expectation values (r) and (rº) in this state, and determine the standard deviation ar. (iii) what is the probability density for a state described by a wave function vér, t)? state the conservation law for the probability density. (iv) calculate the probability current density for the atomic electron in its ground state. give reasons for the result you find. (v) outline the calculation of the probability current density for the atomic elec- tron in an arbitrary bound state y nem. what can you say about the direction of the probability current density vector?

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

answer and explanation;

composition refers to both the types of minerals within a rock and the overall chemical makeup of the rock while texture refers to the size and arrangement of the minerals or grains that make up a rock. both composition and texture can be used to classify rocks, such as igneous rocks. texture describes how the rock became solid or crystallized from liquid, melted rock. composition of a rock describes the minerals that make up a particular rock.