Physics, 23.06.2019 02:10, jaydahh4059

How is science controlled by the governerment

Answers: 1

Show answers

Answers

answered: ggg509

Science is controlled by the government since, in addition to the fact that any scientific advance requires government financial support, it is constantly monitored, in order to "avoid" dangerous advances.

Explanation:

Unfortunately, a great scientific advance can require many funds, which is why scientists usually go to private companies or the government for it to be financed, but even more so, when a scientist carries out a study financed by himself, which leads to an advance a novel scientist, is constantly monitored by governmental entities to identify whether or not such progress represents a danger to the nation or if they must appropriate it.

answered: Guest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

answered: Guest

it doesn't. it was imagined up in the middle ages.

Other questions on the subject: Physics

Physics, 22.06.2019 04:50, bella2331

Asher cycles 12 miles in 16 hours. what is his speed?

Answers: 1

continue

Physics, 22.06.2019 07:00, divadebbgirl1

Examine the equation. 23490th→23088ra+42he what kind of barrier would you need to block the radioactive particles from this reaction? a. a piece of paper b. a sheet of aluminum foil c. a two-inch block of lead d. a solid concrete block

Answers: 1

continue

Physics, 22.06.2019 07:00, chanthonymjones

The cerebellum controls? thirst sensations sleep-wake cycles hand-eye coordination heart rate and pulse

Answers: 1

continue

Physics, 22.06.2019 17:40, cravens511peeelg

The first-order reaction a→2b+c has rate constant 0.538 s−1. if the initial concentration of a is 0.867 mol l−1, what is the half-life of the reaction in seconds? remember to use correct significant figures in your answer (round your answer to the nearest hundredth). do not include units in your response.

Answers: 3

continue

Do you know the correct answer?

How is science controlled by the governerment...