Chemistry, 25.07.2019 23:30, blessing5266

Calculate the ph of 0.726 m anilinium hydrochloride (c6h5nh3cl) solution in water, given that kb for aniline is 3.83 x 10-4.

Answers: 1

Show answers

Answers

answered: psychocatgirl1

The pH of 0.726 M anilinium hydrochloride solution in water is 5.36.

C₆H₅NH₃Cl dissociates completely in water according to the following equation.

C₆H₅NH₃Cl(aq) ⇒ C₆H₅NH₃⁺(aq) + Cl⁻(aq)

Cl⁻ is a very weak base so it can't react with water, whereas C₆H₅NH₃⁺ reacts with water according to the following acid equation.

C₆H₅NH₃⁺(aq) + H₂O(l) ⇒ C₆H₅NH₂(aq) + H₃O⁺

Given Kb for C₆H₅NH₂ is 3.83 × 10⁻⁴, we can calculate Ka for C₆H₅NH₃⁺ using the following expression.

$Ka \times Kb = Kw\\\\Ka = \frac{Kw}{Kb} = \frac{1.00 \times 10^{-14} }{3.83 \times 10^{-4} } = 2.61 \times 10^{-11}$

Given the concentration of C₆H₅NH₃⁺ (Ca) is 0.726 M and the acid dissociation constant (Ka) is 2.61 × 10⁻¹¹, we can calculate [H⁺] using the following expression.

$[H^{+} ] = \sqrt{Ka \times Ca } = \sqrt{(2.61 \times 10^{-11} ) \times 0.726 } = 4.35 \times 10^{-6} M$

The pH of the solution is:

$pH = -log[H^{+} ] = -log (4.35 \times 10^{-6}) = 5.36$

The pH of 0.726 M anilinium hydrochloride solution in water is 5.36.

Learn more: link

Calculate the pH of 0.726 M anilinium hydrochloride (C₆H₅NH₃Cl) solution in water, given that Kb for aniline is 3.83 × 10⁻⁴.

answered: liltonio

First, we have to get Ka:

when Ka = Kw / Kb and we have Kb = 3.83 x 10^-4 & Kw = 1 x 10^-14

∴Ka = (1 x 10^-14) / (3.83 x 10^-4)

= 2.6 x 10^-11

according to the reaction equation:

by using ICE table:

C6H5NH3+ + H2O ↔ C6H5NH2 + H3O+

initial 0.726 0 0

change -X +X +X

Equ (0.726 -X) X X

when Ka = [C6H5NH2][H3O+]/[C6H5NH3+]

by substitution:

2.6 x 10^-11 = X*X / (0.726 -X) by solving for X

∴X = 4.3 x 10^-6

when [H3O+] = X = 4.3 x 10^-6

∴PH = -㏒[H3O+]

= -㏒(4.3 x 10^-6)

= 5.4

answered: Guest

state the principle of separating two immiscible liquids by separating funnel. describe an activity with diagram to separate a mixture of water and kerosene oil. answer: immiscible layers separate out in layers depending on their densities in separating funne

answered: Guest

2b2t

explanation:

2b2t

Other questions on the subject: Chemistry

Chemistry, 21.06.2019 20:50, britotellerialuis

Evaluate this exponential expression,8. (2 + 3)2 – 42

Answers: 3

continue

Chemistry, 22.06.2019 04:00, carog24

Write the empirical chemical formula of calcium with a mass percent of 38.8, phosphorus with a mass percent of 20.0, and oxygen with a mass percent of 41.3.

Answers: 1

continue

Chemistry, 22.06.2019 08:30, ali7862

If i initially have a gas at a pressure of 12 atm, a volume of 23 liters, and a temperature of 200 k, and then i raise the pressure to 14 atm and increase the temperature to 300 k, what is the new volume of the gas?

Answers: 1

continue

Chemistry, 22.06.2019 11:30, claudr03

If we compare and contrast electromagnetic waves with sound waves, all but one statement is true. that is a) sound waves require a medium to travel while electromagnetic waves do not. b) electromagnetic waves can travel through the vacuum of space while sound waves cannot. c) electromagnetic waves must have a medium in which to travel, but sound waves can travel anywhere. eliminate d) sound waves must bounce off of matter in order to travel while electromagnetic waves do not require matter to be present.

Answers: 3

continue

Do you know the correct answer?

Calculate the ph of 0.726 m anilinium hydrochloride (c6h5nh3cl) solution in water, given that kb for...