Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=c h(ch2)2cooh all of these compounds have the same melting point?

The compound with the highest melting point is CH3 [CH2]14COOH.
This compound has the highest melting point because it has the highest number of CH2 bonds. The melting point of a compound refers to a particular temperature at which that substance changes from a solid to a liquid.