Consider the reaction: NaNO3(s)+H2SO4(l)NaSO4(s)+HNO3 delta H= 21.2kj How much heat is absorbed by the reaction system to convert 100g of NaNO3 into NaHSO4(s)?

What are four significant sources of ghgs that come from wostem washington?

The characteristics of two different types of reactions are shown below: reaction a: electrons are gained by the atoms of an element. reaction b: protons are lost by the atom of an element. which statement is true about the atoms of the elements that participate in the two reactions? their identity changes in both reaction a and reaction b. their identity changes in reaction a but not in reaction b. their identity changes in reaction b but not in reaction a. their identity remains the same in both reaction a and reaction b.

11) burning your hand when accidentally touching a hot plate is an example of which heat transfer? a. conduction b. convection c. radiation d. none of these