Chemistry, 19.03.2021 02:20, alyssarene16

For each of the following balanced equations, calcu- late how many grams of each product would form if 12.5 g of the reactant listed first in the equation re- acts completely (there is an excess of the second re- actant). a. SiC(s)+2Cl2(g)=SiCl4(l)+C(s) b. Li2O(s)+H2O(l)=2LiOH(aq)
c.2Na2O2(s)+2H2O(l)=4NaOH(aq)+O2( g)
d. SnO2(s)+2H2(g)=Sn(s)+2H2O(l)

Answers: 1

Show answers

Other questions on the subject: Chemistry

Chemistry, 21.06.2019 15:30, ashtonbillups

Is this a scientific model? use complete sentences to explain why or why not. a graphic organizer showing the water cycle

Answers: 3

continue

Chemistry, 21.06.2019 17:30, girlchamp654

What is the percentage by mass of silicon (si) in iron aluminum silicate (fe3al2(sio4)3)?

Answers: 2

continue

Chemistry, 22.06.2019 14:10, roserose3098

16. in a reaction that has reached equilibrium, a. the forward and reverse reactions are occurring at the same rate. b. the reactants and products are in equal concentrations. c. the forward reaction has gone further than the reverse reaction. d. there are equal numbers of atoms on both sides of the equation. e. a, b, and d are correct.

Answers: 2

continue

Chemistry, 23.06.2019 08:10, 20dyeaubn

Time remaining 58: 10 an atom that has 84 protons and 86 neutrons undergoes a reaction. at the end of the reaction, it has 82 protons and 84 neutrons. what happened to the atom? it accepted radiation in a chemical reaction it donated neutrons to another atom in a chemical reaction it emitted an alpha particle in a nuclear reaction. it accepted protons in a nuclear reaction. mark this and retum save and exit next submit

Answers: 3

continue

Do you know the correct answer?

For each of the following balanced equations, calcu- late how many grams of each product would form...