Balance equation Co2(CO3)3(s)=Co2O3(s)+CoO2(g)

What term is missing from the central region that describes hypotheses, theories, and laws? popular predictable mathematical falsifiable

Inside a flashbulb, oxygen surrounds a thin coil of magnesium. when the flashbulb is set off, a chemical reaction takes place in which magnesium combines with oxygen to form magnesium oxide. which of the chemical equations matches the reaction above? a. mg + o2 mgo2 + energy b. 2mg + o mg2o + energy c. 2mg + o2 2mgo + energy d. mg + o mgo + energy

Which is the solubility product expression for caf2(s)?  [ca2+]/[f–]2  [ca2+][f2–]  [ca]+[f]2  [ca2+][f–]2