Photolithography is the process by which we make the tiny circuits necessary for the tiny transistors in today’s electronics. To do this we must create very thin films of a chemical burn carveout channels that are filled with metal to creat the circuits. One posible candidate for making these thin films is butyltin trichloride, C4H9SnCl3. In the presence water this chemical loosens some of its bound chloride atoms producing hydrochloric acid HCI, arrording to the chemical equation below C4H9SnCl3+H2O=C4H9Sn(OH)2Cl+HCl

What happens when an atom of sulfur combines with two atoms of chlorine to produce sci2? a. each chlorine atom shares a pair of electrons with the sulfur atom. b. an electron is transferred from each chlorine atom to the sulfur atom. c. an electron is transferred from the sulfur atom to each chlorine atom. d. each chlorine atom shares all its valence electrons with the sulfur atom.

Which statement correctly describes the phosphate ion, ? it is composed of one phosphorus atom and four oxygen atoms covalently bonded together, and there is a –3 charge distributed over the entire ion. it is composed of one phosphorus atom and four oxygen atoms covalently bonded together, and there is a –3 charge on the phosphorus atom. it is composed of one phosphorus atom and four oxygen atoms ionically bonded together, and there is a –3 charge distributed over the entire ion. it is composed of one phosphorus atom and four oxygen atoms ionically bonded together, and there is a –3 charge on the phosphorus atom.

What would happen to a volleyball left outside in the winter? o o o o a. it would expand. b. it would lose air. c. it would shrink. d. it would explode.