Draw this molecule in the form of bond line figure.

CHOCH2CH(CH2CH3)CON(CH3)2

Agroup of students is studying convection currents. they fill two identical balloons with the same amount of helium. one balloon is placed in a freezer and the other in an area with warm air. after 10 minutes, the balloons are released from a height of 1 meter. which of the following do the students most likely observe? a. the balloons both rise. the cold balloon is larger than the warm balloon. b. the balloons rise at the same rate. both balloons are the same size. c. the warm balloon expands and rises. the cold balloon shrinks and sinks. d. the cold balloon expands and rises. the warm balloon shrinks and sinks.

Predict the products of the following acid-base reactions, and predict whether the equilibrium lies to the left or to the right of the reaction arrow. part ao2-(aq)+h2o(l)< => express your answer as part of a chemical equation. identify all of the phases in your answer. o2-(aq)+h2o(l) < => oh-(aq)+oh-(aq)part bpredict whether the equilibrium lies to the left or to the right of the equation in previous part. h2o is a stronger acid than oh–, so the equilibrium lies to the right. h2o is a weaker acid than oh–, so the equilibrium lies to the left. h2o is a stronger acid than oh–, so the equilibrium lies to the left. h2o is a weaker acid than oh–, so the equilibrium lies to the right. part cch3cooh(aq)+hs? (aq) < => express your answer as part of a chemical equation. identify all of the phases in your answer. ch3cooh(aq)+hs-(aq) < => h2s(aq)+c2h3o2-(aq)h2s(aq)+c2h3o2-( aq)part dpredict whether the equilibrium lies to the left or to the right of the equation in previous part. ch3cooh is a weaker acid than h2s, so the equilibrium lies to the right. ch3cooh is a weaker acid than h2s, so the equilibrium lies to the left. ch3cooh is a stronger acid than h2s, so the equilibrium lies to the right. ch3cooh is a stronger acid than h2s, so the equilibrium lies to the left. part eno2-(aq)+h2o(l) < => express your answer as part of a chemical equation. identify all of the phases in your answer. no2-(aq)+h2o(l) < => part fpredict whether the equilibrium lies to the left or to the right of the equation in previous part. hno2 is a stronger acid than h2o, so the equilibrium lies to the right. hno2 is a weaker acid than h2o, so the equilibrium lies to the left. hno2 is a stronger acid than h2o, so the equilibrium lies to the left. hno2 is a weaker acid than h2o, so the equilibrium lies to the right.

How many moles of oxygen gas are produced from the decomposition of six moles of potassium