Which of the following is the correct structure of 2-methyl-3-heptene a. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3
b. CH3-CH2CH=CH-CH2CH(CH3)-CH3
c. CH3-CH2-CH=CH-CH-(CH3)-CH2-CH3
d. CH3-CCH(CH3)-CH=CH-CH2CH2-CH3

Which term best describes the form sound takes as it travels away from a drum (a- gas)(b-music) ( c-waves) (d-particles

If you chip a tooth, most likely you will go to the dentist to have the missing material filled in. currently the material used to fill in teeth is a polymer that is flexible when put in, yet is hardened to the strength of a tooth after irradiation with blue light at a wavelength of 461 nm. what is the energy in joules for a photon of light at this wavelength?

Which fact represents evidence for the big bang theory?