When the 1,7-diester CH3O2CCH2CH2CH(CH3)CH2CH2CO2CH3 is treated with sodium methoxide and the reaction mixture is subsequently neutralized with acid, what kind of compound is the major organic product

Which of these would be caused by a chemical change? a) the formation of lava. b) sedimantary rock layering over time. c) metamorphic rock forming from igneous. d) metamorphic rock eroding to form sedimentary rock.

Jenny places a strip of ph paper into a solution. when she removes the ph paper, it has turned yellow-green. what should jenny do next to determine the ph of her solution? a. use a different testing method because the ph paper should not change colors b. place the ph paper into a machine that reads the ph of the solution c. compare the ph paper's color with the color of ph paper from another solution d. compare the ph paper's color with a chart of colors and ph ranges

When utilizing a transmission electron microscope, why is it necessary to stain the specimen with heavy metal salts?