Chemistry, 06.04.2020 20:18, Thejollyhellhound20
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+):
CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3C H2CH2CO2CH2CH3(l)+H2O(l)
Part A
Given 7.60 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield?
Express your answer in grams to three significant figures.
Part B
A chemist ran the reaction and obtained 5.75 g of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.60 g of butanoic acid and excess ethanol?
Express your answer in grams to three significant figures.
Part C
The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.60 g of butanoic acid and excess ethanol?
Express your answer in grams to three significant figures.
Answers: 1
of ethyl butyrate
Other questions on the subject: Chemistry
Chemistry, 22.06.2019 20:00, SpiritedAway7087
In vapor-liquid equilibrium in a binary mixture, both components are generally present in both phases. how many degrees of freedom are there for such a system? the reaction between nitrogen and hydrogen to form ammonia occurs in the gas phase. how many degrees of freedom are there for this system? steam and coal react at high temperatures to form hydrogen, carbon monoxide, carbon dioxide, and methane. the following reactions have been suggested as being involved in the chemical transformation:
Answers: 3
Chemistry, 23.06.2019 04:40, dd123984
Temperature is defined as a. the equivalent of heat. b. a measure of the average kinetic energy of the individual atoms or molecules composing a substance. c. how hot or cold it is. d. the total kinetic energy of the atoms or molecules composing a substance. e. none of the above is correct.
Answers: 1
Do you know the correct answer?
Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry...
Questions in other subjects:
Business, 18.10.2021 17:40
English, 18.10.2021 17:40
